Difference between revisions of "HYDROGEN-PEROXIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Myristoyl-ACPs == * common-name: ** a myristoyl-[acp] == Reaction(s) known to consume the compound == * RXN-10727 * RXN-17017 * [...") |
(Created page with "Category:metabolite == Metabolite NICOTINATE_NUCLEOTIDE == * common-name: ** β-nicotinate d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NICOTINATE_NUCLEOTIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-nicotinate d-ribonucleotide |
| + | * smiles: | ||
| + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) | ||
| + | * inchi-key: | ||
| + | ** jouiqrnqjgxqdc-zyuzmqfosa-l | ||
| + | * molecular-weight: | ||
| + | ** 333.191 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[NICONUCADENYLYLTRAN-RXN]] |
| − | + | * [[RXN-14227]] | |
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[NICOTINATEPRIBOSYLTRANS-RXN]] |
| − | * [[RXN | + | * [[QUINOPRIBOTRANS-RXN]] |
| − | * [[ | + | * [[RXN-8443]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-nicotinate d-ribonucleotide}} |
| + | {{#set: inchi-key=inchikey=jouiqrnqjgxqdc-zyuzmqfosa-l}} | ||
| + | {{#set: molecular-weight=333.191}} | ||
Revision as of 18:53, 14 January 2021
Contents
Metabolite NICOTINATE_NUCLEOTIDE
- common-name:
- β-nicotinate d-ribonucleotide
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
- inchi-key:
- jouiqrnqjgxqdc-zyuzmqfosa-l
- molecular-weight:
- 333.191
