|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=APIGNAR-RXN APIGNAR-RXN] == | + | == Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** naringenin chalcone isomerase | + | ** 15-dehydro-prostaglandin e2 |
| − | ** chalcone isomerase
| + | * smiles: |
| − | * ec-number: | + | ** cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1) |
| − | ** [http://enzyme.expasy.org/EC/5.5.1.6 ec-5.5.1.6] | + | * inchi-key: |
| − | == Reaction formula == | + | ** yrtjdwrobkpznv-kmxmbppjsa-m |
| − | * 1 [[CPD-20012]][c] '''=>''' 1 [[NARINGENIN-CMPD]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 349.446 |
| − | * Gene: [[SJ09285]] | + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]] | + | * [[1.1.1.141-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]]
| + | * [[1.1.1.141-RXN]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ20427]] | + | {{#set: common-name=15-dehydro-prostaglandin e2}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=yrtjdwrobkpznv-kmxmbppjsa-m}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: molecular-weight=349.446}} |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[PWY1F-FLAVSYN]], flavonoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-FLAVSYN PWY1F-FLAVSYN] | |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-6787]], flavonoid biosynthesis (in equisetum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6787 PWY-6787]
| |
| − | ** '''6''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-7397]], naringenin biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7397 PWY-7397]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7897]], flavonoid di-C-glucosylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7897 PWY-7897]
| |
| − | ** '''3''' reactions found over '''15''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02446 R02446]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P11650 P11650]
| |
| − | ** [http://www.uniprot.org/uniprot/P11651 P11651]
| |
| − | ** [http://www.uniprot.org/uniprot/P41088 P41088]
| |
| − | ** [http://www.uniprot.org/uniprot/P14298 P14298]
| |
| − | ** [http://www.uniprot.org/uniprot/Q42925 Q42925]
| |
| − | ** [http://www.uniprot.org/uniprot/Q42926 Q42926]
| |
| − | ** [http://www.uniprot.org/uniprot/Q08704 Q08704]
| |
| − | ** [http://www.uniprot.org/uniprot/P28012 P28012]
| |
| − | ** [http://www.uniprot.org/uniprot/P41089 P41089]
| |
| − | ** [http://www.uniprot.org/uniprot/O81980 O81980]
| |
| − | ** [http://www.uniprot.org/uniprot/O22604 O22604]
| |
| − | ** [http://www.uniprot.org/uniprot/O22651 O22651]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43754 Q43754]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=chalcone isomerase|naringenin chalcone isomerase}} | |
| − | {{#set: ec-number=ec-5.5.1.6}}
| |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=4}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
