Difference between revisions of "HYDROXY-915-DIOXOPROSTA-13-ENOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TESTOSTERONE == * common-name: ** testosterone * smiles: ** cc34([ch]2([ch]([ch]1(c(c)(c(o)cc1)cc2))ccc3=cc(=o)cc4)) * inchi-key: ** mumg...")
(Created page with "Category:metabolite == Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE == * common-name: ** 15-dehydro-prostaglandin e2 * smiles: ** cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)c...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TESTOSTERONE ==
+
== Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE ==
 
* common-name:
 
* common-name:
** testosterone
+
** 15-dehydro-prostaglandin e2
 
* smiles:
 
* smiles:
** cc34([ch]2([ch]([ch]1(c(c)(c(o)cc1)cc2))ccc3=cc(=o)cc4))
+
** cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
 
* inchi-key:
 
* inchi-key:
** mumggozamzwbjj-dykiifrcsa-n
+
** yrtjdwrobkpznv-kmxmbppjsa-m
 
* molecular-weight:
 
* molecular-weight:
** 288.429
+
** 349.446
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.51-RXN]]
+
* [[1.1.1.141-RXN]]
* [[RXN66-343]]
 
* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.64-RXN]]
+
* [[1.1.1.141-RXN]]
* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=testosterone}}
+
{{#set: common-name=15-dehydro-prostaglandin e2}}
{{#set: inchi-key=inchikey=mumggozamzwbjj-dykiifrcsa-n}}
+
{{#set: inchi-key=inchikey=yrtjdwrobkpznv-kmxmbppjsa-m}}
{{#set: molecular-weight=288.429}}
+
{{#set: molecular-weight=349.446}}

Latest revision as of 11:15, 18 March 2021

Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE

  • common-name:
    • 15-dehydro-prostaglandin e2
  • smiles:
    • cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
  • inchi-key:
    • yrtjdwrobkpznv-kmxmbppjsa-m
  • molecular-weight:
    • 349.446

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality