Difference between revisions of "HYDROXY-915-DIOXOPROSTA-13-ENOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.3.43-RXN 3.6.3.43-RXN] == * direction: ** left-to-right * common-name: ** peptide-transporting...")
 
(Created page with "Category:metabolite == Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE == * common-name: ** 15-dehydro-prostaglandin e2 * smiles: ** cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.3.43-RXN 3.6.3.43-RXN] ==
+
== Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** peptide-transporting atpase
+
** 15-dehydro-prostaglandin e2
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.6.3.43 ec-3.6.3.43]
+
** cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[Peptides-holder]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Peptides-holder]][e] '''+''' 1 [[Pi]][c]
+
** yrtjdwrobkpznv-kmxmbppjsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06172]]
+
** 349.446
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[1.1.1.141-RXN]]
−
* Gene: [[SJ02793]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[1.1.1.141-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=15-dehydro-prostaglandin e2}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=yrtjdwrobkpznv-kmxmbppjsa-m}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=349.446}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14430 14430]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=peptide-transporting atpase}}
 
−
{{#set: ec-number=ec-3.6.3.43}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE

  • common-name:
    • 15-dehydro-prostaglandin e2
  • smiles:
    • cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
  • inchi-key:
    • yrtjdwrobkpznv-kmxmbppjsa-m
  • molecular-weight:
    • 349.446

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=HYDROXY-915-DIOXOPROSTA-13-ENOATE&oldid=138574"