Difference between revisions of "HYDROXY-METHYL-BUTENYL-DIP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cyclic-2-3-Ribonucleoside-Monophosphates == * common-name: ** a ribonucleoside 2',3'-cyclic phosphate == Reaction(s) known to consume the...")
(Created page with "Category:metabolite == Metabolite HYDROXY-METHYL-BUTENYL-DIP == * common-name: ** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate * smiles: ** cc(co)=ccop(op([o-])(=o)[o-]...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cyclic-2-3-Ribonucleoside-Monophosphates ==
+
== Metabolite HYDROXY-METHYL-BUTENYL-DIP ==
 
* common-name:
 
* common-name:
** a ribonucleoside 2',3'-cyclic phosphate
+
** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
 +
* smiles:
 +
** cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
 +
* inchi-key:
 +
** mdsizrkjvdmqoq-gorduthdsa-k
 +
* molecular-weight:
 +
** 259.069
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.4.37-RXN]]
+
* [[HDS]]
 +
* [[IDS1]]
 +
* [[IDS2]]
 +
* [[ISPH2-RXN]]
 +
* [[RXN0-884]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HDS]]
 +
* [[RXN-15878]]
 +
* [[RXN0-882]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ribonucleoside 2',3'-cyclic phosphate}}
+
{{#set: common-name=(e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}}
 +
{{#set: inchi-key=inchikey=mdsizrkjvdmqoq-gorduthdsa-k}}
 +
{{#set: molecular-weight=259.069}}

Latest revision as of 11:14, 18 March 2021

Metabolite HYDROXY-METHYL-BUTENYL-DIP

  • common-name:
    • (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
  • smiles:
    • cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
  • inchi-key:
    • mdsizrkjvdmqoq-gorduthdsa-k
  • molecular-weight:
    • 259.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality