Difference between revisions of "HYDROXYMETHYLBILANE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETOLACTOSE == * common-name: ** 3'-ketolactose * smiles: ** c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2) * inchi-key: ** hkkhtab...") |
(Created page with "Category:metabolite == Metabolite HYDROXYMETHYLBILANE == * common-name: ** preuroporphyrinogen * smiles: ** c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(cc...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HYDROXYMETHYLBILANE == |
* common-name: | * common-name: | ||
− | ** | + | ** preuroporphyrinogen |
* smiles: | * smiles: | ||
− | ** c(o) | + | ** c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(ccc(=o)[o-])=c(n2)cc4(=c(cc([o-])=o)c(ccc(=o)[o-])=c(cc3(=c(cc([o-])=o)c(ccc(=o)[o-])=cn3))n4))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wdfjyrzcziubpr-uhfffaoysa-f |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 846.757 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[UROGENIIISYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[OHMETHYLBILANESYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=preuroporphyrinogen}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wdfjyrzcziubpr-uhfffaoysa-f}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=846.757}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite HYDROXYMETHYLBILANE
- common-name:
- preuroporphyrinogen
- smiles:
- c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(ccc(=o)[o-])=c(n2)cc4(=c(cc([o-])=o)c(ccc(=o)[o-])=c(cc3(=c(cc([o-])=o)c(ccc(=o)[o-])=cn3))n4)))
- inchi-key:
- wdfjyrzcziubpr-uhfffaoysa-f
- molecular-weight:
- 846.757