Difference between revisions of "HYDROXYMETHYLBILANE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02300 == * transcription-direction: ** positive * right-end-position: ** 111195 * left-end-position: ** 77475 * centisome-position: ** 55.87247...") |
(Created page with "Category:metabolite == Metabolite HYDROXYMETHYLBILANE == * common-name: ** preuroporphyrinogen * smiles: ** c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(cc...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite HYDROXYMETHYLBILANE == |
| − | * | + | * common-name: |
| − | ** | + | ** preuroporphyrinogen |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(ccc(=o)[o-])=c(n2)cc4(=c(cc([o-])=o)c(ccc(=o)[o-])=c(cc3(=c(cc([o-])=o)c(ccc(=o)[o-])=cn3))n4))) |
| − | * | + | * inchi-key: |
| − | ** | + | ** wdfjyrzcziubpr-uhfffaoysa-f |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 846.757 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[UROGENIIISYN-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[OHMETHYLBILANESYN-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=preuroporphyrinogen}} | |
| − | + | {{#set: inchi-key=inchikey=wdfjyrzcziubpr-uhfffaoysa-f}} | |
| − | + | {{#set: molecular-weight=846.757}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite HYDROXYMETHYLBILANE
- common-name:
- preuroporphyrinogen
- smiles:
- c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(ccc(=o)[o-])=c(n2)cc4(=c(cc([o-])=o)c(ccc(=o)[o-])=c(cc3(=c(cc([o-])=o)c(ccc(=o)[o-])=cn3))n4)))
- inchi-key:
- wdfjyrzcziubpr-uhfffaoysa-f
- molecular-weight:
- 846.757
