Difference between revisions of "HYDROXYPRODEG-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * common-name: ** dcdp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)...")
 
(Created page with "Category:pathway == Pathway HYDROXYPRODEG-PWY == * taxonomic-range: ** tax-33208 * common-name: ** trans-4-hydroxy-l-proline degradation i == Reaction(s) found == * 4OH2...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] ==
+
== Pathway HYDROXYPRODEG-PWY ==
 +
* taxonomic-range:
 +
** tax-33208
 
* common-name:
 
* common-name:
** dcdp
+
** trans-4-hydroxy-l-proline degradation i
* smiles:
+
== Reaction(s) found ==
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
+
* [[4OH2OXOGLUTARALDOL-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** ftdhdkpuhblbtl-shyzeuofsa-k
+
* [NoneRXN66-545 RXN66-545]
* molecular-weight:
+
* [None4-HYDROXYGLUTAMATE-AMINOTRANSFERASE-RXN 4-HYDROXYGLUTAMATE-AMINOTRANSFERASE-RXN]
** 384.155
+
* [NoneRXN-14472 RXN-14472]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-14471 RXN-14471]
* [[ATDCD]]
+
{{#set: taxonomic-range=tax-33208}}
* [[ATDCDm]]
+
{{#set: common-name=trans-4-hydroxy-l-proline degradation i}}
* [[DCDPKIN-RXN]]
+
{{#set: nb reaction found=1}}
* [[DCTPtm]]
+
{{#set: completion rate=0.2}}
* [[RXN-14187]]
+
{{#set: nb total reaction=5}}
== Reaction(s) known to produce the compound ==
 
* [[ATDCM]]
 
* [[CDPREDUCT-RXN]]
 
* [[DCDT]]
 
* [[DCTCP]]
 
* [[DCTPtm]]
 
* [[DCTUP]]
 
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 
* [[RXN-14216]]
 
* [[RXN-7913]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=dcdp}}
 
{{#set: inchi-key=inchikey=ftdhdkpuhblbtl-shyzeuofsa-k}}
 
{{#set: molecular-weight=384.155}}
 

Latest revision as of 10:59, 18 March 2021

Pathway HYDROXYPRODEG-PWY

  • taxonomic-range:
    • tax-33208
  • common-name:
    • trans-4-hydroxy-l-proline degradation i

Reaction(s) found

Reaction(s) not found

  • [NoneRXN66-545 RXN66-545]
  • [None4-HYDROXYGLUTAMATE-AMINOTRANSFERASE-RXN 4-HYDROXYGLUTAMATE-AMINOTRANSFERASE-RXN]
  • [NoneRXN-14472 RXN-14472]
  • [NoneRXN-14471 RXN-14471]