Difference between revisions of "HYDROXYPROPANAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13172 == * common-name: ** 6-hydroxy-2-cyclohexen-one-carboxylate * smiles: ** c(=o)(c1(o)(c=cccc(=o)1))[o-] * inchi-key: ** wezwwzku...") |
(Created page with "Category:metabolite == Metabolite Polynucleotide-Holder == * common-name: ** a generic polynucleotide substrate == Reaction(s) known to consume the compound == * 3.1.31....") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Polynucleotide-Holder == |
* common-name: | * common-name: | ||
| − | ** | + | ** a generic polynucleotide substrate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[3.1.31.1-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[POLYNUCLEOTIDE-3-PHOSPHATASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a generic polynucleotide substrate}} |
| − | |||
| − | |||
Revision as of 11:17, 15 January 2021
Contents
Metabolite Polynucleotide-Holder
- common-name:
- a generic polynucleotide substrate
