Difference between revisions of "HYDROXYPROPANAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-725 == * common-name: ** 13(s)-hpote * smiles: ** ccc=ccc(c=cc=ccccccccc([o-])=o)oo * inchi-key: ** uyqgvdxdxbaabn-fqsphkrjsa-m * mol...") |
(Created page with "Category:metabolite == Metabolite HYDROXYPROPANAL == * common-name: ** 3-hydroxypropionaldehyde * smiles: ** c([ch]=o)co * inchi-key: ** akxkfzdcryjktf-uhfffaoysa-n * mole...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HYDROXYPROPANAL == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-hydroxypropionaldehyde |
* smiles: | * smiles: | ||
− | ** | + | ** c([ch]=o)co |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** akxkfzdcryjktf-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 74.079 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[GLYCEROL-DEHYDRATASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-hydroxypropionaldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=akxkfzdcryjktf-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=74.079}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite HYDROXYPROPANAL
- common-name:
- 3-hydroxypropionaldehyde
- smiles:
- c([ch]=o)co
- inchi-key:
- akxkfzdcryjktf-uhfffaoysa-n
- molecular-weight:
- 74.079