Difference between revisions of "HYDROXYPROPANAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-725 == * common-name: ** 13(s)-hpote * smiles: ** ccc=ccc(c=cc=ccccccccc([o-])=o)oo * inchi-key: ** uyqgvdxdxbaabn-fqsphkrjsa-m * mol...") |
(Created page with "Category:metabolite == Metabolite A-GALACTOSYLCERAMIDE == * common-name: ** a β-d-galactosyl-n-acylsphingosine == Reaction(s) known to consume the compound == * RXN...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite A-GALACTOSYLCERAMIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** a β-d-galactosyl-n-acylsphingosine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-18301]] |
+ | * [[RXN-18302]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a β-d-galactosyl-n-acylsphingosine}} |
− | |||
− |
Revision as of 14:58, 5 January 2021
Contents
Metabolite A-GALACTOSYLCERAMIDE
- common-name:
- a β-d-galactosyl-n-acylsphingosine