Difference between revisions of "HYDRPHENYLAC-CPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8089 == * common-name: ** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc...")
(Created page with "Category:metabolite == Metabolite HYDRPHENYLAC-CPD == * common-name: ** (4-hydroxyphenyl)acetaldehyde * smiles: ** [ch](=o)cc1(c=cc(o)=cc=1) * inchi-key: ** iprppfiavhpvjh...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8089 ==
+
== Metabolite HYDRPHENYLAC-CPD ==
 
* common-name:
 
* common-name:
** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine
+
** (4-hydroxyphenyl)acetaldehyde
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** [ch](=o)cc1(c=cc(o)=cc=1)
 
* inchi-key:
 
* inchi-key:
** lpdgucimnbnwej-bxzvqshesa-n
+
** iprppfiavhpvjh-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 782.092
+
** 136.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8330]]
+
* [[RXN3O-4113]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8321]]
+
* [[RXN-5821]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-α-linolenoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: common-name=(4-hydroxyphenyl)acetaldehyde}}
{{#set: inchi-key=inchikey=lpdgucimnbnwej-bxzvqshesa-n}}
+
{{#set: inchi-key=inchikey=iprppfiavhpvjh-uhfffaoysa-n}}
{{#set: molecular-weight=782.092}}
+
{{#set: molecular-weight=136.15}}

Latest revision as of 11:11, 18 March 2021

Metabolite HYDRPHENYLAC-CPD

  • common-name:
    • (4-hydroxyphenyl)acetaldehyde
  • smiles:
    • [ch](=o)cc1(c=cc(o)=cc=1)
  • inchi-key:
    • iprppfiavhpvjh-uhfffaoysa-n
  • molecular-weight:
    • 136.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality