Difference between revisions of "HYPOXANTHINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)...") |
(Created page with "Category:metabolite == Metabolite HYPOXANTHINE == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=o)2)) * inchi-key: ** fdgqstzjbfjubt-uhfffaoysa-n * mole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HYPOXANTHINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** hypoxanthine |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc2(=c(n=1)n=cnc(=o)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fdgqstzjbfjubt-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 136.113 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DEOXYINOPHOSPHOR-RXN]] | ||
| + | * [[HPRT]] | ||
| + | * [[HYPOXANPRIBOSYLTRAN-RXN]] | ||
| + | * [[INOPHOSPHOR-RXN]] | ||
| + | * [[RXN-7682]] | ||
| + | * [[XANDH]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[DEOXYINOPHOSPHOR-RXN]] |
| + | * [[HPRT]] | ||
| + | * [[INOPHOSPHOR-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hypoxanthine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fdgqstzjbfjubt-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=136.113}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite HYPOXANTHINE
- common-name:
- hypoxanthine
- smiles:
- c1(nc2(=c(n=1)n=cnc(=o)2))
- inchi-key:
- fdgqstzjbfjubt-uhfffaoysa-n
- molecular-weight:
- 136.113
