Difference between revisions of "HYPOXANTHINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12237 == * transcription-direction: ** negative * right-end-position: ** 196218 * left-end-position: ** 175413 * centisome-position: ** 48.70608...") |
(Created page with "Category:metabolite == Metabolite HYPOXANTHINE == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=o)2)) * inchi-key: ** fdgqstzjbfjubt-uhfffaoysa-n * mole...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite HYPOXANTHINE == |
| − | * | + | * common-name: |
| − | ** | + | ** hypoxanthine |
| − | * | + | * smiles: |
| − | ** | + | ** c1(nc2(=c(n=1)n=cnc(=o)2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** fdgqstzjbfjubt-uhfffaoysa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 136.113 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[DEOXYINOPHOSPHOR-RXN]] | |
| − | == Reaction(s) | + | * [[HPRT]] |
| − | * [[ | + | * [[HYPOXANPRIBOSYLTRAN-RXN]] |
| − | * | + | * [[INOPHOSPHOR-RXN]] |
| − | * | + | * [[RXN-7682]] |
| − | * [[ | + | * [[XANDH]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[DEOXYINOPHOSPHOR-RXN]] |
| − | * | + | * [[HPRT]] |
| − | * | + | * [[INOPHOSPHOR-RXN]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=hypoxanthine}} | |
| − | + | {{#set: inchi-key=inchikey=fdgqstzjbfjubt-uhfffaoysa-n}} | |
| − | {{#set: | + | {{#set: molecular-weight=136.113}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite HYPOXANTHINE
- common-name:
- hypoxanthine
- smiles:
- c1(nc2(=c(n=1)n=cnc(=o)2))
- inchi-key:
- fdgqstzjbfjubt-uhfffaoysa-n
- molecular-weight:
- 136.113
