Difference between revisions of "HYPOXANTHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11087 == * transcription-direction: ** negative * right-end-position: ** 23220 * left-end-position: ** 13135 * centisome-position: ** 54.227562...")
(Created page with "Category:metabolite == Metabolite HYPOXANTHINE == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=o)2)) * inchi-key: ** fdgqstzjbfjubt-uhfffaoysa-n * mole...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11087 ==
+
== Metabolite HYPOXANTHINE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** hypoxanthine
−
* right-end-position:
+
* smiles:
−
** 23220
+
** c1(nc2(=c(n=1)n=cnc(=o)2))
−
* left-end-position:
+
* inchi-key:
−
** 13135
+
** fdgqstzjbfjubt-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 54.227562   
+
** 136.113
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[DEOXYINOPHOSPHOR-RXN]]
−
== Reaction(s) associated ==
+
* [[HPRT]]
−
* [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
+
* [[HYPOXANPRIBOSYLTRAN-RXN]]
−
** Category: [[annotation]]
+
* [[INOPHOSPHOR-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-7682]]
−
* [[RXN-13404]]
+
* [[XANDH]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DEOXYINOPHOSPHOR-RXN]]
−
* [[RXN-13405]]
+
* [[HPRT]]
−
** Category: [[annotation]]
+
* [[INOPHOSPHOR-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-13406]]
+
{{#set: common-name=hypoxanthine}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=fdgqstzjbfjubt-uhfffaoysa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=136.113}}
−
* [[RXN-9679]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-9680]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[P541-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6004]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=23220}}
 
−
{{#set: left-end-position=13135}}
 
−
{{#set: centisome-position=54.227562    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite HYPOXANTHINE

  • common-name:
    • hypoxanthine
  • smiles:
    • c1(nc2(=c(n=1)n=cnc(=o)2))
  • inchi-key:
    • fdgqstzjbfjubt-uhfffaoysa-n
  • molecular-weight:
    • 136.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=HYPOXANTHINE&oldid=137223"