Difference between revisions of "Heparan-NAc-Glc-6S"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11404 == * common-name: ** 3,3',5-triiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2)) * inchi-key:...")
(Created page with "Category:metabolite == Metabolite Heparan-NAc-Glc-6S == * common-name: ** [heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate == Reaction(s) known to consume the...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11404 ==
+
== Metabolite Heparan-NAc-Glc-6S ==
 
* common-name:
 
* common-name:
** 3,3',5-triiodothyroacetate
+
** [heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate
* smiles:
 
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2))
 
* inchi-key:
 
** uowzuvnaguaeqc-uhfffaoysa-m
 
* molecular-weight:
 
** 620.928
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10618]]
+
* [[3.1.6.14-RXN]]
* [[RXN-10619]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,3',5-triiodothyroacetate}}
+
{{#set: common-name=[heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate}}
{{#set: inchi-key=inchikey=uowzuvnaguaeqc-uhfffaoysa-m}}
 
{{#set: molecular-weight=620.928}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Heparan-NAc-Glc-6S

  • common-name:
    • [heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.