Difference between revisions of "Heparan-NAc-Glc-6S"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11404 == * common-name: ** 3,3',5-triiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Heparan-NAc-Glc-6S == * common-name: ** [heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate == Reaction(s) known to consume the...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Heparan-NAc-Glc-6S == |
* common-name: | * common-name: | ||
− | ** | + | ** [heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.1.6.14-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=[heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Heparan-NAc-Glc-6S
- common-name:
- [heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.