Difference between revisions of "Heparan-NAc-Glc-6S"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11404 == * common-name: ** 3,3',5-triiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite 2-OH-3-Methyl-Saturated-Fatty-Acyl-CoA == * common-name: ** a 2-hydroxy-3-methyl-branched 2,3,4-saturated fatty acyl-coa == Reaction(s) k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-OH-3-Methyl-Saturated-Fatty-Acyl-CoA == |
* common-name: | * common-name: | ||
| − | ** 3,3 | + | ** a 2-hydroxy-3-methyl-branched 2,3,4-saturated fatty acyl-coa |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-470]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3,3 | + | {{#set: common-name=a 2-hydroxy-3-methyl-branched 2,3,4-saturated fatty acyl-coa}} |
| − | |||
| − | |||
Revision as of 15:30, 5 January 2021
Contents
Metabolite 2-OH-3-Methyl-Saturated-Fatty-Acyl-CoA
- common-name:
- a 2-hydroxy-3-methyl-branched 2,3,4-saturated fatty acyl-coa
