Difference between revisions of "Heparan-sulfate-D-GlcNS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TTP == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite Heparan-sulfate-D-GlcNS == * common-name: ** a [heparan sulfate]-α-d-n-sulfoglucosamine == Reaction(s) known to consume the compoun...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Heparan-sulfate-D-GlcNS == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [heparan sulfate]-α-d-n-sulfoglucosamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.8.2.23-RXN]] |
| − | + | * [[2.8.2.29-RXN]] | |
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HEPARITIN-SULFOTRANSFERASE-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [heparan sulfate]-α-d-n-sulfoglucosamine}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Heparan-sulfate-D-GlcNS
- common-name:
- a [heparan sulfate]-α-d-n-sulfoglucosamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [heparan sulfate]-α-d-n-sulfoglucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
