Difference between revisions of "Heparan-sulfate-D-GlcNS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1401 RXN-1401] == * direction: ** left-to-right * common-name: ** tryptamine oxidase * ec-numbe...")
(Created page with "Category:metabolite == Metabolite CPD-10814 == * common-name: ** glycyl-l-proline * smiles: ** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-]) * inchi-key: ** kznqnbzmbzjqjo-yfkpbyrvsa-n...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1401 RXN-1401] ==
+
== Metabolite CPD-10814 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** tryptamine oxidase
+
** glycyl-l-proline
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.4.3.4 ec-1.4.3.4]
+
** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-])
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[TRYPTAMINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[INDOLE_ACETALDEHYDE]][c]
+
** kznqnbzmbzjqjo-yfkpbyrvsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07831]]
+
** 172.183
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-6988]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-6307]], L-tryptophan degradation X (mammalian, via tryptamine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6307 PWY-6307]
+
== Reaction(s) of unknown directionality ==
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
{{#set: common-name=glycyl-l-proline}}
−
* [[PWY-3181]], L-tryptophan degradation VI (via tryptamine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3181 PWY-3181]
+
{{#set: inchi-key=inchikey=kznqnbzmbzjqjo-yfkpbyrvsa-n}}
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
{{#set: molecular-weight=172.183}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02173 R02173]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=tryptamine oxidase}}
 
−
{{#set: ec-number=ec-1.4.3.4}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-10814

  • common-name:
    • glycyl-l-proline
  • smiles:
    • c1(n(c(=o)c[n+])c(cc1)c(=o)[o-])
  • inchi-key:
    • kznqnbzmbzjqjo-yfkpbyrvsa-n
  • molecular-weight:
    • 172.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Heparan-sulfate-D-GlcNS&oldid=48227"