Difference between revisions of "Hepta-oxo-hexadecanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cis-delta-3-decenoyl-ACPs == * common-name: ** a (3z)-dec-3-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN0-2141 =...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-L-KYNURENINE == * common-name: ** 3-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-HYDROXY-L-KYNURENINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-hydroxy-l-kynurenine |
| + | * smiles: | ||
| + | ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) | ||
| + | * inchi-key: | ||
| + | ** vckpuufaignjhc-lurjtmiesa-n | ||
| + | * molecular-weight: | ||
| + | ** 224.216 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10721]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] | ||
| + | * [[RXN-10721]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-hydroxy-l-kynurenine}} |
| + | {{#set: inchi-key=inchikey=vckpuufaignjhc-lurjtmiesa-n}} | ||
| + | {{#set: molecular-weight=224.216}} | ||
Revision as of 08:24, 15 March 2021
Contents
Metabolite 3-HYDROXY-L-KYNURENINE
- common-name:
- 3-hydroxy-l-kynurenine
- smiles:
- c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1)
- inchi-key:
- vckpuufaignjhc-lurjtmiesa-n
- molecular-weight:
- 224.216
