Difference between revisions of "Hepta-oxo-hexadecanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYCYTIDINE == * common-name: ** 2'-deoxycytidine * smiles: ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) * inchi-key: ** cktsbutuhbmzgz-shy...") |
(Created page with "Category:metabolite == Metabolite Hepta-oxo-hexadecanoyl-ACPs == * common-name: ** a 3,5,7,9,11,13,15-hepta-oxo-hexadecanoyl-[pks-acp] == Reaction(s) known to consume the...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Hepta-oxo-hexadecanoyl-ACPs == |
* common-name: | * common-name: | ||
− | ** | + | ** a 3,5,7,9,11,13,15-hepta-oxo-hexadecanoyl-[pks-acp] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1A0-6303]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 3,5,7,9,11,13,15-hepta-oxo-hexadecanoyl-[pks-acp]}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Hepta-oxo-hexadecanoyl-ACPs
- common-name:
- a 3,5,7,9,11,13,15-hepta-oxo-hexadecanoyl-[pks-acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 3,5,7,9,11,13,15-hepta-oxo-hexadecanoyl-[pks-acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.