Difference between revisions of "Hepta-oxo-hexadecanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18136 == * transcription-direction: ** positive * right-end-position: ** 199535 * left-end-position: ** 169115 * centisome-position: ** 67.15603...")
(Created page with "Category:metabolite == Metabolite CPD-13404 == * common-name: ** l-alanyl-l-aspartate * smiles: ** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o * inchi-key: ** xaewtdmgfghwfk-imjs...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18136 ==
+
== Metabolite CPD-13404 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** l-alanyl-l-aspartate
−
* right-end-position:
+
* smiles:
−
** 199535
+
** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 169115
+
** xaewtdmgfghwfk-imjsidkusa-m
−
* centisome-position:
+
* molecular-weight:
−
** 67.15603   
+
** 203.174
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN0-6975]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[1.1.1.34-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=l-alanyl-l-aspartate}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=xaewtdmgfghwfk-imjsidkusa-m}}
−
* [[ATPASE-RXN]]
+
{{#set: molecular-weight=203.174}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-922]]
 
−
** '''7''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6174]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7391]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7524]]
 
−
** '''5''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=199535}}
 
−
{{#set: left-end-position=169115}}
 
−
{{#set: centisome-position=67.15603    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=8}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD-13404

  • common-name:
    • l-alanyl-l-aspartate
  • smiles:
    • cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o
  • inchi-key:
    • xaewtdmgfghwfk-imjsidkusa-m
  • molecular-weight:
    • 203.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Hepta-oxo-hexadecanoyl-ACPs&oldid=45551"