Difference between revisions of "Hepta-oxo-hexadecanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Lipid-dihydrosterculate == * common-name: ** a [glycerolipid]-dihydrosterculate == Reaction(s) known to consume the compound == == Reacti...") |
(Created page with "Category:metabolite == Metabolite CAMP == * common-name: ** cyclic-amp * smiles: ** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34)) * inchi-key: ** ivomouwhdpkr...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CAMP == |
* common-name: | * common-name: | ||
| − | ** | + | ** cyclic-amp |
| + | * smiles: | ||
| + | ** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34)) | ||
| + | * inchi-key: | ||
| + | ** ivomouwhdpkrll-kqynxxcusa-m | ||
| + | * molecular-weight: | ||
| + | ** 328.201 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-5038]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[ADENYLATECYC-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cyclic-amp}} |
| + | {{#set: inchi-key=inchikey=ivomouwhdpkrll-kqynxxcusa-m}} | ||
| + | {{#set: molecular-weight=328.201}} | ||
Revision as of 13:07, 14 January 2021
Contents
Metabolite CAMP
- common-name:
- cyclic-amp
- smiles:
- c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34))
- inchi-key:
- ivomouwhdpkrll-kqynxxcusa-m
- molecular-weight:
- 328.201
