Difference between revisions of "Hexanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == * common-name: ** luteolin 7-o-β-d-diglucuronide * smiles: ** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc...")
(Created page with "Category:metabolite == Metabolite Hexanoyl-ACPs == * common-name: ** a hexanoyl-[acyl-carrier-protein] == Reaction(s) known to consume the compound == * RXN-9523 * R...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE ==
+
== Metabolite Hexanoyl-ACPs ==
 
* common-name:
 
* common-name:
** luteolin 7-o-β-d-diglucuronide
+
** a hexanoyl-[acyl-carrier-protein]
* smiles:
 
** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
 
* inchi-key:
 
** pbbvwjqpazyqdb-dbfweqbmsa-l
 
* molecular-weight:
 
** 636.476
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15288]]
+
* [[RXN-9523]]
 +
* [[RXN-9650]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9521]]
 +
* [[RXN-9658]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=luteolin 7-o-β-d-diglucuronide}}
+
{{#set: common-name=a hexanoyl-[acyl-carrier-protein]}}
{{#set: inchi-key=inchikey=pbbvwjqpazyqdb-dbfweqbmsa-l}}
 
{{#set: molecular-weight=636.476}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Hexanoyl-ACPs

  • common-name:
    • a hexanoyl-[acyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a hexanoyl-[acyl-carrier-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.