Difference between revisions of "Hexanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BIOTIN == * common-name: ** biotin * smiles: ** c1(sc(ccccc(=o)[o-])[ch]2(nc(=o)n[ch]12)) * inchi-key: ** ybjhbahktgyvgt-zkwxmuahsa-m * m...")
(Created page with "Category:metabolite == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == * common-name: ** luteolin 7-o-β-d-diglucuronide * smiles: ** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BIOTIN ==
+
== Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE ==
 
* common-name:
 
* common-name:
** biotin
+
** luteolin 7-o-β-d-diglucuronide
 
* smiles:
 
* smiles:
** c1(sc(ccccc(=o)[o-])[ch]2(nc(=o)n[ch]12))
+
** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
 
* inchi-key:
 
* inchi-key:
** ybjhbahktgyvgt-zkwxmuahsa-m
+
** pbbvwjqpazyqdb-dbfweqbmsa-l
 
* molecular-weight:
 
* molecular-weight:
** 243.3
+
** 636.476
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[6.3.4.10-RXN]]
+
* [[RXN-15288]]
* [[6.3.4.11-RXN]]
 
* [[6.3.4.9-RXN]]
 
* [[BIOTINLIG-RXN]]
 
* [[ExchangeSeed-BIOTIN]]
 
* [[RXN0-7192]]
 
* [[TransportSeed-BIOTIN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.8.1.6-RXN]]
 
* [[ExchangeSeed-BIOTIN]]
 
* [[RXN-17473]]
 
* [[TransportSeed-BIOTIN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=biotin}}
+
{{#set: common-name=luteolin 7-o-β-d-diglucuronide}}
{{#set: inchi-key=inchikey=ybjhbahktgyvgt-zkwxmuahsa-m}}
+
{{#set: inchi-key=inchikey=pbbvwjqpazyqdb-dbfweqbmsa-l}}
{{#set: molecular-weight=243.3}}
+
{{#set: molecular-weight=636.476}}

Revision as of 13:11, 14 January 2021

Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE

  • common-name:
    • luteolin 7-o-β-d-diglucuronide
  • smiles:
    • c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
  • inchi-key:
    • pbbvwjqpazyqdb-dbfweqbmsa-l
  • molecular-weight:
    • 636.476

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality