Difference between revisions of "Histone-Acetyl-Lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALLYSINE == * common-name: ** (s)-2-amino-6-oxohexanoate * smiles: ** [ch](=o)cccc([n+])c(=o)[o-] * inchi-key: ** gfxytqpnnxgict-yfkpbyrv...") |
(Created page with "Category:metabolite == Metabolite CPD0-2108 == * common-name: ** (2e)-oct-2-enoyl-coa * smiles: ** cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2108 == |
* common-name: | * common-name: | ||
− | ** ( | + | ** (2e)-oct-2-enoyl-coa |
* smiles: | * smiles: | ||
− | ** [ | + | ** cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** cpsdnaxxkwvyiy-ntlmcjqisa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 887.685 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14229]] | ||
+ | * [[RXN-14276]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ACOA80OR]] |
+ | * [[RXN-12669]] | ||
+ | * [[RXN-14229]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=(2e)-oct-2-enoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cpsdnaxxkwvyiy-ntlmcjqisa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=887.685}} |
Revision as of 08:25, 15 March 2021
Contents
Metabolite CPD0-2108
- common-name:
- (2e)-oct-2-enoyl-coa
- smiles:
- cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
- inchi-key:
- cpsdnaxxkwvyiy-ntlmcjqisa-j
- molecular-weight:
- 887.685