Difference between revisions of "Histone-Acetyl-Lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HYPOXANTHINE == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=o)2)) * inchi-key: ** fdgqstzjbfjubt-uhfffaoysa-n * mole...") |
(Created page with "Category:metabolite == Metabolite Histone-Acetyl-Lysine == * common-name: ** a [histone]-n6-acetyl-l-lysine == Reaction(s) known to consume the compound == * 3.5.1.98-RX...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Histone-Acetyl-Lysine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [histone]-n6-acetyl-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.5.1.98-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HISTONE-ACETYLTRANSFERASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [histone]-n6-acetyl-l-lysine}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Histone-Acetyl-Lysine
- common-name:
- a [histone]-n6-acetyl-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [histone]-n6-acetyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
