Difference between revisions of "Histone-Acetyl-Lysine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GAP == * common-name: ** d-glyceraldehyde 3-phosphate * smiles: ** [ch](=o)c(o)cop(=o)([o-])[o-] * inchi-key: ** lxjxrirhzlfyrp-vkhmyheas...")
(Created page with "Category:metabolite == Metabolite HYPOXANTHINE == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=o)2)) * inchi-key: ** fdgqstzjbfjubt-uhfffaoysa-n * mole...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GAP ==
+
== Metabolite HYPOXANTHINE ==
 
* common-name:
 
* common-name:
** d-glyceraldehyde 3-phosphate
+
** hypoxanthine
 
* smiles:
 
* smiles:
** [ch](=o)c(o)cop(=o)([o-])[o-]
+
** c1(nc2(=c(n=1)n=cnc(=o)2))
 
* inchi-key:
 
* inchi-key:
** lxjxrirhzlfyrp-vkhmyheasa-l
+
** fdgqstzjbfjubt-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 168.043
+
** 136.113
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1TRANSKETO-RXN]]
+
* [[DEOXYINOPHOSPHOR-RXN]]
* [[2TRANSKETO-RXN]]
+
* [[HPRT]]
* [[DEHYDDEOXPHOSGALACT-ALDOL-RXN]]
+
* [[HYPOXANPRIBOSYLTRAN-RXN]]
* [[DXS-RXN]]
+
* [[INOPHOSPHOR-RXN]]
* [[F16ALDOLASE-RXN]]
+
* [[RXN-7682]]
* [[FBA_]]
+
* [[XANDH]]
* [[GAPDHSYNEC-RXN]]
 
* [[GAPDH_]]
 
* [[GAPOXNPHOSPHN-RXN]]
 
* [[RXN-11322]]
 
* [[RXN-12590]]
 
* [[RXN-3443]]
 
* [[RXN0-2381]]
 
* [[TRANSALDOL-RXN]]
 
* [[TRIOSEPISOMERIZATION-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1TRANSKETO-RXN]]
+
* [[DEOXYINOPHOSPHOR-RXN]]
* [[2TRANSKETO-RXN]]
+
* [[HPRT]]
* [[DEHYDDEOXPHOSGALACT-ALDOL-RXN]]
+
* [[INOPHOSPHOR-RXN]]
* [[F16ALDOLASE-RXN]]
 
* [[FBA_]]
 
* [[GAPDHSYNEC-RXN]]
 
* [[GAPDH_]]
 
* [[GAPOXNPHOSPHN-RXN]]
 
* [[KDPGALDOL-RXN]]
 
* [[RXN0-2381]]
 
* [[TAGAALDOL-RXN]]
 
* [[TRANSALDOL-RXN]]
 
* [[TRIOKINASE-RXN]]
 
* [[TRIOSEPISOMERIZATION-RXN]]
 
* [[TRYPSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glyceraldehyde 3-phosphate}}
+
{{#set: common-name=hypoxanthine}}
{{#set: inchi-key=inchikey=lxjxrirhzlfyrp-vkhmyheasa-l}}
+
{{#set: inchi-key=inchikey=fdgqstzjbfjubt-uhfffaoysa-n}}
{{#set: molecular-weight=168.043}}
+
{{#set: molecular-weight=136.113}}

Revision as of 13:08, 14 January 2021

Metabolite HYPOXANTHINE

  • common-name:
    • hypoxanthine
  • smiles:
    • c1(nc2(=c(n=1)n=cnc(=o)2))
  • inchi-key:
    • fdgqstzjbfjubt-uhfffaoysa-n
  • molecular-weight:
    • 136.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality