Difference between revisions of "Histone-L-arginines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15280 == * common-name: ** hercynine * smiles: ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** gppytcrvkhuljh-qmmmgpobsa-n * m...") |
(Created page with "Category:metabolite == Metabolite L-IDONATE == * common-name: ** l-idonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sknvomklsa-m * molecul...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-IDONATE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-idonate |
* smiles: | * smiles: | ||
− | ** c | + | ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rghnjxzeokukbd-sknvomklsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 195.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12107]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-idonate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rghnjxzeokukbd-sknvomklsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=195.149}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite L-IDONATE
- common-name:
- l-idonate
- smiles:
- c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
- inchi-key:
- rghnjxzeokukbd-sknvomklsa-m
- molecular-weight:
- 195.149