Difference between revisions of "Histone-L-arginines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SINAPOYL-COA == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(oc...")
(Created page with "Category:metabolite == Metabolite Histone-L-arginines == * common-name: ** [histone]-l-arginine == Reaction(s) known to consume the compound == * 2.1.1.125-RXN == Reac...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SINAPOYL-COA ==
+
== Metabolite Histone-L-arginines ==
 
* common-name:
 
* common-name:
** sinapoyl-coa
+
** [histone]-l-arginine
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** rbfuwesmwrugfy-gsnioflcsa-j
 
* molecular-weight:
 
** 969.7
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1124]]
+
* [[2.1.1.125-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10919]]
 
* [[RXN-1124]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sinapoyl-coa}}
+
{{#set: common-name=[histone]-l-arginine}}
{{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}}
 
{{#set: molecular-weight=969.7}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite Histone-L-arginines

  • common-name:
    • [histone]-l-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "histone]-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.