Difference between revisions of "Holo-Transcarboxylases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP == * common-name: ** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine * smiles: ** cc1(n=c(n)c(=cn=...")
(Created page with "Category:metabolite == Metabolite holo-Transcarboxylases == * common-name: ** a holo-[methylmalonyl-coa:pyruvate carboxytransferase] == Reaction(s) known to consume the co...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP ==
+
== Metabolite holo-Transcarboxylases ==
 
* common-name:
 
* common-name:
** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine
+
** a holo-[methylmalonyl-coa:pyruvate carboxytransferase]
* smiles:
 
** cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)
 
* inchi-key:
 
** agqjqcfepuvxnk-uhfffaoysa-k
 
* molecular-weight:
 
** 296.093
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12610]]
 
* [[RXN-12611]]
 
* [[THI-P-SYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PYRIMSYN3-RXN]]
+
* [[6.3.4.9-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-amino-2-methyl-5-(diphosphomethyl)pyrimidine}}
+
{{#set: common-name=a holo-[methylmalonyl-coa:pyruvate carboxytransferase]}}
{{#set: inchi-key=inchikey=agqjqcfepuvxnk-uhfffaoysa-k}}
 
{{#set: molecular-weight=296.093}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite holo-Transcarboxylases

  • common-name:
    • a holo-[methylmalonyl-coa:pyruvate carboxytransferase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a holo-[methylmalonyl-coa:pyruvate carboxytransferase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.