Difference between revisions of "Holo-VibB"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10664 == * common-name: ** 5-methylsalicylate * smiles: ** cc1(=cc(=c(c=c1)o)c([o-])=o) * inchi-key: ** dlgbegbhxsaqoc-uhfffaoysa-m *...")
(Created page with "Category:metabolite == Metabolite L-Glutaminyl-Peptides == * common-name: ** an n-terminal l-glutaminyl-[protein] == Reaction(s) known to consume the compound == == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10664 ==
+
== Metabolite L-Glutaminyl-Peptides ==
 
* common-name:
 
* common-name:
** 5-methylsalicylate
+
** an n-terminal l-glutaminyl-[protein]
* smiles:
 
** cc1(=cc(=c(c=c1)o)c([o-])=o)
 
* inchi-key:
 
** dlgbegbhxsaqoc-uhfffaoysa-m
 
* molecular-weight:
 
** 151.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10079]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17893]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methylsalicylate}}
+
{{#set: common-name=an n-terminal l-glutaminyl-[protein]}}
{{#set: inchi-key=inchikey=dlgbegbhxsaqoc-uhfffaoysa-m}}
 
{{#set: molecular-weight=151.141}}
 

Revision as of 15:27, 5 January 2021

Metabolite L-Glutaminyl-Peptides

  • common-name:
    • an n-terminal l-glutaminyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-glutaminyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.