Difference between revisions of "Hyaluronan-NAc-glucosaminide"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PRPP == * common-name: ** 5-phospho-α-d-ribose 1-diphosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o...")
(Created page with "Category:metabolite == Metabolite Protein-tauphospho-L-histidines == * common-name: ** a [protein]-nτ-phospho-l-histidine == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PRPP ==
+
== Metabolite Protein-tauphospho-L-histidines ==
 
* common-name:
 
* common-name:
** 5-phospho-α-d-ribose 1-diphosphate
+
** a [protein]-nτ-phospho-l-histidine
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)
 
* inchi-key:
 
** pqgcedqwhsbajp-txicztdvsa-i
 
* molecular-weight:
 
** 385.031
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENPRIBOSYLTRAN-RXN]]
+
* [[RXN-17132]]
* [[ADPART]]
 
* [[APPRT]]
 
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 
* [[GUANPRIBOSYLTRAN-RXN]]
 
* [[HPRT]]
 
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 
* [[OROPRIBTRANS-RXN]]
 
* [[ORPRT]]
 
* [[PRPPAMIDOTRANS-RXN]]
 
* [[PRPPSYN-RXN]]
 
* [[PRTRANS-RXN]]
 
* [[QUINOPRIBOTRANS-RXN]]
 
* [[RPDPK]]
 
* [[RXN-14270]]
 
* [[URACIL-PRIBOSYLTRANS-RXN]]
 
* [[XPPRT]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[APPRT]]
 
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 
* [[GUANPRIBOSYLTRAN-RXN]]
 
* [[HPRT]]
 
* [[OROPRIBTRANS-RXN]]
 
* [[ORPRT]]
 
* [[PRPPAMIDOTRANS-RXN]]
 
* [[PRPPSYN-RXN]]
 
* [[PRTRANS-RXN]]
 
* [[R5PDP]]
 
* [[RPDPK]]
 
* [[XPPRT]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-phospho-α-d-ribose 1-diphosphate}}
+
{{#set: common-name=a [protein]-nτ-phospho-l-histidine}}
{{#set: inchi-key=inchikey=pqgcedqwhsbajp-txicztdvsa-i}}
 
{{#set: molecular-weight=385.031}}
 

Revision as of 15:28, 5 January 2021

Metabolite Protein-tauphospho-L-histidines

  • common-name:
    • a [protein]-nτ-phospho-l-histidine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-nτ-phospho-l-histidine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.