Difference between revisions of "Hypoxanthine-37-In-tRNA-Alanines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE-P == * common-name: ** thiamine phosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite THIAMINE-P ==
+
== Metabolite CPD-4209 ==
 
* common-name:
 
* common-name:
−
** thiamine phosphate
+
** n6-dimethylallyladenine
 
* smiles:
 
* smiles:
−
** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+
** cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
 
* inchi-key:
 
* inchi-key:
−
** hzsajdvwzrbgif-uhfffaoysa-m
+
** hyvabzigrdekcd-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 343.317
+
** 203.246
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-3542]]
+
* [[1.5.99.12-RXN]]
 +
* [[RXN-4315]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12610]]
+
* [[1.5.99.12-RXN]]
−
* [[RXN-12611]]
+
* [[RXN-4313]]
−
* [[RXN0-3542]]
+
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
−
* [[THI-P-SYN-RXN]]
+
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
 +
* [[RXN-4315]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=thiamine phosphate}}
+
{{#set: common-name=n6-dimethylallyladenine}}
−
{{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}}
−
{{#set: molecular-weight=343.317}}
+
{{#set: molecular-weight=203.246}}

Revision as of 11:15, 15 January 2021

Metabolite CPD-4209

  • common-name:
    • n6-dimethylallyladenine
  • smiles:
    • cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
  • inchi-key:
    • hyvabzigrdekcd-uhfffaoysa-n
  • molecular-weight:
    • 203.246

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Hypoxanthine-37-In-tRNA-Alanines&oldid=111940"