Difference between revisions of "Hypoxanthine-37-In-tRNA-Alanines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite Hypoxanthine-37-In-tRNA-Alanines == * common-name: ** a hypoxanthine37 in trnaala == Reaction(s) known to consume the compound == * RXN...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Hypoxanthine-37-In-tRNA-Alanines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a hypoxanthine37 in trnaala |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-13996]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-13996]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a hypoxanthine37 in trnaala}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Hypoxanthine-37-In-tRNA-Alanines
- common-name:
- a hypoxanthine37 in trnaala
