Difference between revisions of "Hypoxanthine-In-tRNAs-34s"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == * common-name: ** 3,4-dihydroxyphenylglycolaldehyde * smiles: ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite RNA-DNA-hybrids == * common-name: ** a rna-dna hybrid == Reaction(s) known to consume the compound == * 3.1.26.4-RXN == Reaction(s) k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RNA-DNA-hybrids == |
* common-name: | * common-name: | ||
| − | ** | + | ** a rna-dna hybrid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.26.4-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a rna-dna hybrid}} |
| − | |||
| − | |||
Revision as of 08:29, 15 March 2021
Contents
Metabolite RNA-DNA-hybrids
- common-name:
- a rna-dna hybrid
