Difference between revisions of "I-antigens"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15172 == * common-name: ** 6,7-dehydrobaicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3))) * inchi-key: ** ls...") |
(Created page with "Category:metabolite == Metabolite CPD-12128 == * common-name: ** menaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12128 == |
* common-name: | * common-name: | ||
| − | ** | + | ** menaquinol-11 |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zxhqkrgmwkzwgn-ryzszpjesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 923.499 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9362]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menaquinol-11}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zxhqkrgmwkzwgn-ryzszpjesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=923.499}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-12128
- common-name:
- menaquinol-11
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
- inchi-key:
- zxhqkrgmwkzwgn-ryzszpjesa-n
- molecular-weight:
- 923.499
