Difference between revisions of "I-antigens"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15172 == * common-name: ** 6,7-dehydrobaicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3))) * inchi-key: ** ls...") |
(Created page with "Category:metabolite == Metabolite I-antigens == * common-name: ** an i antigen == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite I-antigens == |
* common-name: | * common-name: | ||
− | ** | + | ** an i antigen |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-15278]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an i antigen}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite I-antigens
- common-name:
- an i antigen