Difference between revisions of "I-antigens"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE == * common-name: ** 2-deoxy-d-glucose 6-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1) * in...") |
(Created page with "Category:metabolite == Metabolite CPD-69 == * common-name: ** cyanate * smiles: ** c([o-])#n * inchi-key: ** xljmaioerfsogz-uhfffaoysa-m * molecular-weight: ** 42.017 == R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-69 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cyanate |
* smiles: | * smiles: | ||
| − | ** c | + | ** c([o-])#n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xljmaioerfsogz-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 42.017 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R524-RXN]] |
| + | * [[RXN-12893]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cyanate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xljmaioerfsogz-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=42.017}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-69
- common-name:
- cyanate
- smiles:
- c([o-])#n
- inchi-key:
- xljmaioerfsogz-uhfffaoysa-m
- molecular-weight:
- 42.017
