Difference between revisions of "I-antigens"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-69 == * common-name: ** cyanate * smiles: ** c([o-])#n * inchi-key: ** xljmaioerfsogz-uhfffaoysa-m * molecular-weight: ** 42.017 == R...") |
(Created page with "Category:metabolite == Metabolite CPD-693 == * common-name: ** 2-cis-abscisate * smiles: ** cc(=cc([o-])=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o * inchi-key: ** jlidbldqvayhne-ykal...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-693 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-cis-abscisate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cc([o-])=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jlidbldqvayhne-ykalocixsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 263.313 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.2.3.14-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-cis-abscisate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jlidbldqvayhne-ykalocixsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=263.313}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-693
- common-name:
- 2-cis-abscisate
- smiles:
- cc(=cc([o-])=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
- inchi-key:
- jlidbldqvayhne-ykalocixsa-m
- molecular-weight:
- 263.313
