Difference between revisions of "I-antigens"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18308 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...") |
(Created page with "Category:metabolite == Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE == * common-name: ** 2-deoxy-d-glucose 6-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1) * in...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE == |
| − | == | + | * common-name: |
| − | * [[ | + | ** 2-deoxy-d-glucose 6-phosphate |
| − | == Reaction(s) | + | * smiles: |
| − | + | ** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1) | |
| − | + | * inchi-key: | |
| − | + | ** uqjfzaagzayvkz-cermhhmhsa-l | |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 242.122 |
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[3.1.3.68-RXN]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=2-deoxy-d-glucose 6-phosphate}} | ||
| + | {{#set: inchi-key=inchikey=uqjfzaagzayvkz-cermhhmhsa-l}} | ||
| + | {{#set: molecular-weight=242.122}} | ||
Revision as of 20:32, 18 December 2020
Contents
Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE
- common-name:
- 2-deoxy-d-glucose 6-phosphate
- smiles:
- c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1)
- inchi-key:
- uqjfzaagzayvkz-cermhhmhsa-l
- molecular-weight:
- 242.122
