Difference between revisions of "IDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07990 == * transcription-direction: ** negative * right-end-position: ** 399605 * left-end-position: ** 383778 * centisome-position: ** 86.118195...")
 
(Created page with "Category:metabolite == Metabolite IDP == * common-name: ** idp * smiles: ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** jpxzqm...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ07990 ==
+
== Metabolite IDP ==
* transcription-direction:
+
* common-name:
** negative
+
** idp
* right-end-position:
+
* smiles:
** 399605
+
** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
* left-end-position:
+
* inchi-key:
** 383778
+
** jpxzqmkkfwmmgk-kqynxxcusa-k
* centisome-position:
+
* molecular-weight:
** 86.118195   
+
** 425.165
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ADP-DEAMINASE-RXN]]
== Reaction(s) associated ==
+
* [[ATID]]
* [[2.7.11.2-RXN]]
+
* [[ATIDm]]
** Category: [[annotation]]
+
* [[RXN-14003]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14120]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[ADP-DEAMINASE-RXN]]
* [[2.7.11.4-RXN]]
+
* [[ITCY]]
** Category: [[orthology]]
+
* [[ITUP]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-14120]]
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN0-5073]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=idp}}
{{#set: transcription-direction=negative}}
+
{{#set: inchi-key=inchikey=jpxzqmkkfwmmgk-kqynxxcusa-k}}
{{#set: right-end-position=399605}}
+
{{#set: molecular-weight=425.165}}
{{#set: left-end-position=383778}}
 
{{#set: centisome-position=86.118195    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite IDP

  • common-name:
    • idp
  • smiles:
    • c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • jpxzqmkkfwmmgk-kqynxxcusa-k
  • molecular-weight:
    • 425.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality