Difference between revisions of "IDP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07990 == * transcription-direction: ** negative * right-end-position: ** 399605 * left-end-position: ** 383778 * centisome-position: ** 86.118195...") |
(Created page with "Category:metabolite == Metabolite IDP == * common-name: ** idp * smiles: ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** jpxzqm...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite IDP == |
− | * | + | * common-name: |
− | ** | + | ** idp |
− | * | + | * smiles: |
− | ** | + | ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
− | * | + | * inchi-key: |
− | ** | + | ** jpxzqmkkfwmmgk-kqynxxcusa-k |
− | * | + | * molecular-weight: |
− | ** | + | ** 425.165 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[ADP-DEAMINASE-RXN]] | |
− | == Reaction(s) | + | * [[ATID]] |
− | * [[ | + | * [[ATIDm]] |
− | * | + | * [[RXN-14003]] |
− | * | + | * [[RXN-14120]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[ADP-DEAMINASE-RXN]] |
− | * [[ | + | * [[ITCY]] |
− | * | + | * [[ITUP]] |
− | * | + | * [[RXN-14120]] |
− | * [[ | + | * [[RXN0-5073]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=idp}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=jpxzqmkkfwmmgk-kqynxxcusa-k}} |
− | {{#set: | + | {{#set: molecular-weight=425.165}} |
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite IDP
- common-name:
- idp
- smiles:
- c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- jpxzqmkkfwmmgk-kqynxxcusa-k
- molecular-weight:
- 425.165