Difference between revisions of "IDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: ** jzrwcgzrtzmzeh-uhfffaoysa-...")
(Created page with "Category:metabolite == Metabolite CPD-13118 == * common-name: ** gdp-β-l-fucose * smiles: ** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THIAMINE ==
+
== Metabolite CPD-13118 ==
 
* common-name:
 
* common-name:
** thiamine
+
** gdp-β-l-fucose
 
* smiles:
 
* smiles:
** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
+
** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
 
* inchi-key:
 
* inchi-key:
** jzrwcgzrtzmzeh-uhfffaoysa-n
+
** lqebexmhblqmdb-jgqubwhwsa-l
 
* molecular-weight:
 
* molecular-weight:
** 265.352
+
** 587.33
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ExchangeSeed-THIAMINE]]
+
* [[2.4.1.221-RXN]]
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
+
* [[2.4.1.68-RXN]]
* [[THIAMINASE-RXN]]
+
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
* [[TransportSeed-THIAMINE]]
+
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
 +
* [[RXN-9463]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-THIAMINE]]
+
* [[1.1.1.271-RXN]]
* [[TransportSeed-THIAMINE]]
+
* [[2.4.1.221-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine}}
+
{{#set: common-name=gdp-β-l-fucose}}
{{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}}
{{#set: molecular-weight=265.352}}
+
{{#set: molecular-weight=587.33}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-13118

  • common-name:
    • gdp-β-l-fucose
  • smiles:
    • cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
  • inchi-key:
    • lqebexmhblqmdb-jgqubwhwsa-l
  • molecular-weight:
    • 587.33

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality