Difference between revisions of "IDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17780 RXN-17780] == * direction: ** left-to-right * common-name: ** enoyl-coa hydratase * ec-nu...")
(Created page with "Category:metabolite == Metabolite IDP == * common-name: ** idp * smiles: ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** jpxzqm...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17780 RXN-17780] ==
+
== Metabolite IDP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** enoyl-coa hydratase
+
** idp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.2.1.17 ec-4.2.1.17]
+
** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-19170]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-19168]][c]
+
** jpxzqmkkfwmmgk-kqynxxcusa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 425.165
−
* Gene: [[SJ10275]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[ADP-DEAMINASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ATID]]
−
* Gene: [[SJ14591]]
+
* [[ATIDm]]
−
** Category: [[annotation]]
+
* [[RXN-14003]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-14120]]
−
* Gene: [[SJ03913]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[ADP-DEAMINASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ITCY]]
−
** Category: [[orthology]]
+
* [[ITUP]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-14120]]
−
* Gene: [[SJ03584]]
+
* [[RXN0-5073]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=idp}}
−
* Gene: [[SJ07211]]
+
{{#set: inchi-key=inchikey=jpxzqmkkfwmmgk-kqynxxcusa-k}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=425.165}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ21390]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=enoyl-coa hydratase}}
 
−
{{#set: ec-number=ec-4.2.1.17}}
 
−
{{#set: nb gene associated=6}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite IDP

  • common-name:
    • idp
  • smiles:
    • c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • jpxzqmkkfwmmgk-kqynxxcusa-k
  • molecular-weight:
    • 425.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=IDP&oldid=138456"