Difference between revisions of "IDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.3.5-RXN 1.8.3.5-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org...")
(Created page with "Category:metabolite == Metabolite IDP == * common-name: ** idp * smiles: ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** jpxzqm...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.3.5-RXN 1.8.3.5-RXN] ==
+
== Metabolite IDP ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** idp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.8.3.5 ec-1.8.3.5]
+
** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[S-PRENYL-L-CYSTEINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CYS]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[PRENAL]][c]
+
** jpxzqmkkfwmmgk-kqynxxcusa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03172]]
+
** 425.165
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ADP-DEAMINASE-RXN]]
−
** Category: [[orthology]]
+
* [[ATID]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ATIDm]]
−
== Pathway(s) ==
+
* [[RXN-14003]]
−
== Reconstruction information  ==
+
* [[RXN-14120]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ADP-DEAMINASE-RXN]]
−
== External links  ==
+
* [[ITCY]]
−
* LIGAND-RXN:
+
* [[ITUP]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R07360 R07360]
+
* [[RXN-14120]]
−
{{#set: direction=left-to-right}}
+
* [[RXN0-5073]]
−
{{#set: ec-number=ec-1.8.3.5}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: nb gene associated=1}}
+
{{#set: common-name=idp}}
−
{{#set: nb pathway associated=0}}
+
{{#set: inchi-key=inchikey=jpxzqmkkfwmmgk-kqynxxcusa-k}}
−
{{#set: reconstruction category=annotation|orthology}}
+
{{#set: molecular-weight=425.165}}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite IDP

  • common-name:
    • idp
  • smiles:
    • c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • jpxzqmkkfwmmgk-kqynxxcusa-k
  • molecular-weight:
    • 425.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=IDP&oldid=138456"