Difference between revisions of "ILE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-NITROSOGLUTATHIONE == * common-name: ** s-nitrosoglutathione * smiles: ** c(sn=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite L-THYROXINE == * common-name: ** l-thyroxine * smiles: ** c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-THYROXINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-thyroxine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xuiikfgfijcvmt-lbprgkrzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 776.874 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10606]] |
| + | * [[RXN-10608]] | ||
| + | * [[RXN-10614]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-thyroxine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xuiikfgfijcvmt-lbprgkrzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=776.874}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite L-THYROXINE
- common-name:
- l-thyroxine
- smiles:
- c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
- inchi-key:
- xuiikfgfijcvmt-lbprgkrzsa-n
- molecular-weight:
- 776.874
