Difference between revisions of "ILE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-NITROSOGLUTATHIONE == * common-name: ** s-nitrosoglutathione * smiles: ** c(sn=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite ILE == * common-name: ** l-isoleucine * smiles: ** ccc(c)c([n+])c(=o)[o-] * inchi-key: ** agpkzvbtjjnpag-whfbiakzsa-n * molecular-weight:...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ILE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-isoleucine |
* smiles: | * smiles: | ||
− | ** c | + | ** ccc(c)c([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** agpkzvbtjjnpag-whfbiakzsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 131.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] |
+ | * [[ISOLEUCINE--TRNA-LIGASE-RXN]] | ||
+ | * [[RXN-16292]] | ||
+ | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-isoleucine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=agpkzvbtjjnpag-whfbiakzsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=131.174}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite ILE
- common-name:
- l-isoleucine
- smiles:
- ccc(c)c([n+])c(=o)[o-]
- inchi-key:
- agpkzvbtjjnpag-whfbiakzsa-n
- molecular-weight:
- 131.174