Difference between revisions of "ILE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-NITROSOGLUTATHIONE == * common-name: ** s-nitrosoglutathione * smiles: ** c(sn=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-ke...")
(Created page with "Category:metabolite == Metabolite CPD-8163 == * common-name: ** 1-16:0-2-18:2-digalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(oc(coc2(oc(coc1(oc(co)c(o)c(o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-NITROSOGLUTATHIONE ==
+
== Metabolite CPD-8163 ==
 
* common-name:
 
* common-name:
** s-nitrosoglutathione
+
** 1-16:0-2-18:2-digalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** c(sn=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** cccccc=ccc=ccccccccc(oc(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))coc(=o)ccccccccccccccc)=o
 
* inchi-key:
 
* inchi-key:
** hyhsbsxuhzoylx-wdskdsinsa-m
+
** qzxmupatkglzap-gnspkctrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 335.311
+
** 917.225
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17884]]
+
* [[RXN-8365]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-nitrosoglutathione}}
+
{{#set: common-name=1-16:0-2-18:2-digalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=hyhsbsxuhzoylx-wdskdsinsa-m}}
+
{{#set: inchi-key=inchikey=qzxmupatkglzap-gnspkctrsa-n}}
{{#set: molecular-weight=335.311}}
+
{{#set: molecular-weight=917.225}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-8163

  • common-name:
    • 1-16:0-2-18:2-digalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(oc(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))coc(=o)ccccccccccccccc)=o
  • inchi-key:
    • qzxmupatkglzap-gnspkctrsa-n
  • molecular-weight:
    • 917.225

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality