Difference between revisions of "ILE-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARBAMYUL-L-ASPARTATE == * common-name: ** n-carbamoyl-l-aspartate * smiles: ** c(=o)([o-])cc(nc(n)=o)c([o-])=o * inchi-key: ** hlkxyzvta...") |
(Created page with "Category:metabolite == Metabolite ILE-tRNAs == * common-name: ** a trnaile == Reaction(s) known to consume the compound == * ISOLEUCINE--TRNA-LIGASE-RXN == Reaction(s)...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ILE-tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** a trnaile |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ISOLEUCINE--TRNA-LIGASE-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a trnaile}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite ILE-tRNAs
- common-name:
- a trnaile