Difference between revisions of "ILE-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19151 == * common-name: ** (s)-3-hydroxy-(5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
(Created page with "Category:metabolite == Metabolite ILE-tRNAs == * common-name: ** a trnaile == Reaction(s) known to consume the compound == * ISOLEUCINE--TRNA-LIGASE-RXN == Reaction(s)...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19151 ==
+
== Metabolite ILE-tRNAs ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-(5z)-dodecenoyl-coa
+
** a trnaile
* smiles:
 
** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** ayordfmyybnsbo-qccsjadrsa-j
 
* molecular-weight:
 
** 959.791
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17798]]
+
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17797]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-(5z)-dodecenoyl-coa}}
+
{{#set: common-name=a trnaile}}
{{#set: inchi-key=inchikey=ayordfmyybnsbo-qccsjadrsa-j}}
 
{{#set: molecular-weight=959.791}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite ILE-tRNAs

  • common-name:
    • a trnaile

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality